C14H24O3S — CID 176603916
2-[3-(cyclopentylidenemethoxy)propyl]thiane 1,1-dioxide (PubChem CID 176603916) has the molecular formula C14H24O3S and a molecular weight of 272.41 g/mol. Its IUPAC name is 2-[3-(cyclopentylidenemethoxy)propyl]thiane 1,1-dioxide.
| Compound Name | 2-[3-(cyclopentylidenemethoxy)propyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 176603916 |
| Molecular Formula | C14H24O3S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-[3-(cyclopentylidenemethoxy)propyl]thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1CCCOC=C1CCCC1 |
| InChI | InChI=1S/C14H24O3S/c15-18(16)11-4-3-8-14(18)9-5-10-17-12-13-6-1-2-7-13/h12,14H,1-11H2 |
| InChIKey | NKLBQKAWZRDXDG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|