C12H20O3S — CID 176604024
3-[2-(cyclohexylidenemethoxy)ethyl]thietane 1,1-dioxide (PubChem CID 176604024) has the molecular formula C12H20O3S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-[2-(cyclohexylidenemethoxy)ethyl]thietane 1,1-dioxide.
| Compound Name | 3-[2-(cyclohexylidenemethoxy)ethyl]thietane 1,1-dioxide |
|---|---|
| PubChem CID | 176604024 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-[2-(cyclohexylidenemethoxy)ethyl]thietane 1,1-dioxide |
| SMILES | O=S1(=O)CC(CCOC=C2CCCCC2)C1 |
| InChI | InChI=1S/C12H20O3S/c13-16(14)9-12(10-16)6-7-15-8-11-4-2-1-3-5-11/h8,12H,1-7,9-10H2 |
| InChIKey | YMZGNYGNPBITHP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|