C41H49F4O8S2- — CID 176604085
2,3,5,6-tetrafluoro-4-[5-(2,4,6-tricyclohexylphenyl)sulfonyloxyadamantane-2-carbonyl]oxybenzenesulfonate (PubChem CID 176604085) has the molecular formula C41H49F4O8S2- and a molecular weight of 809.96 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[5-(2,4,6-tricyclohexylphenyl)sulfonyloxyadamantane-2-carbonyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[5-(2,4,6-tricyclohexylphenyl)sulfonyloxyadamantane-2-carbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176604085 |
| Molecular Formula | C41H49F4O8S2- |
| Molecular Weight | 809.96 g/mol |
| Exact Mass | 809.28 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[5-(2,4,6-tricyclohexylphenyl)sulfonyloxyadamantane-2-carbonyl]oxybenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)C1C2CC3CC1CC(OS(=O)(=O)c1c(C4CCCCC4)cc(C4CCCCC4)cc1C1CCCCC1)(C3)C2 |
| InChI | InChI=1S/C41H50F4O8S2/c42-33-35(44)39(54(47,48)49)36(45)34(43)37(33)52-40(46)32-28-16-23-17-29(32)22-41(20-23,21-28)53-55(50,51)38-30(25-12-6-2-7-13-25)18-27(24-10-4-1-5-11-24)19-31(38)26-14-8-3-9-15-26/h18-19,23-26,28-29,32H,1-17,20-22H2,(H,47,48,49)/p-1 |
| InChIKey | BSWCZYNRQRWEOF-UHFFFAOYSA-M |
| XLogP | 9.80 |
| TPSA | 126.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.96 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|