C38H45F4O7S- — CID 176604165
2,3,5,6-tetrafluoro-4-[4-(2,4,6-tricyclohexylbenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate (PubChem CID 176604165) has the molecular formula C38H45F4O7S- and a molecular weight of 721.83 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tricyclohexylbenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tricyclohexylbenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate |
|---|---|
| PubChem CID | 176604165 |
| Molecular Formula | C38H45F4O7S- |
| Molecular Weight | 721.83 g/mol |
| Exact Mass | 721.28 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(2,4,6-tricyclohexylbenzoyl)oxycyclohexanecarbonyl]oxybenzenesulfonate |
| SMILES | O=C(OC1CCC(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)CC1)c1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C38H46F4O7S/c39-31-33(41)36(50(45,46)47)34(42)32(40)35(31)49-37(43)25-16-18-27(19-17-25)48-38(44)30-28(23-12-6-2-7-13-23)20-26(22-10-4-1-5-11-22)21-29(30)24-14-8-3-9-15-24/h20-25,27H,1-19H2,(H,45,46,47)/p-1 |
| InChIKey | GYJGUOZGTJUKOF-UHFFFAOYSA-M |
| XLogP | 9.61 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.83 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|