C42H42F4O9S2 — CID 176604252
2,3,5,6-tetrafluoro-4-[4-(2-oxo-1-adamantyl)-2,6-bis(4-oxo-1-adamantyl)phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 176604252) has the molecular formula C42H42F4O9S2 and a molecular weight of 830.91 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[4-(2-oxo-1-adamantyl)-2,6-bis(4-oxo-1-adamantyl)phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[4-(2-oxo-1-adamantyl)-2,6-bis(4-oxo-1-adamantyl)phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176604252 |
| Molecular Formula | C42H42F4O9S2 |
| Molecular Weight | 830.91 g/mol |
| Exact Mass | 830.22 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[4-(2-oxo-1-adamantyl)-2,6-bis(4-oxo-1-adamantyl)phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | O=C1C2CC3CC1CC(c1cc(C45CC6CC(CC(C6)C4=O)C5)cc(C45CC6CC(C4)C(=O)C(C6)C5)c1S(=O)(=O)Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)(C3)C2 |
| InChI | InChI=1S/C42H42F4O9S2/c43-30-32(45)38(56(50,51)52)33(46)31(44)36(30)55-57(53,54)37-28(40-10-20-4-23(14-40)34(47)24(5-20)15-40)8-27(42-12-18-1-19(13-42)3-22(2-18)39(42)49)9-29(37)41-11-21-6-25(16-41)35(48)26(7-21)17-41/h8-9,18-26H,1-7,10-17H2,(H,50,51,52) |
| InChIKey | NSNAEVFQGLRJDE-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.91 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|