About 2-(1-ethenoxyethyl)-1,4-dithiane
2-(1-ethenoxyethyl)-1,4-dithiane (PubChem CID 176604272) has the molecular formula C8H14OS2
and a molecular weight of 190.33 g/mol. Its IUPAC name is 2-(1-ethenoxyethyl)-1,4-dithiane.
Molecular Properties
| Compound Name | 2-(1-ethenoxyethyl)-1,4-dithiane |
| PubChem CID | 176604272 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-(1-ethenoxyethyl)-1,4-dithiane |
| SMILES | C=COC(C)C1CSCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-3-9-7(2)8-6-10-4-5-11-8/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | OGGLRXPMQIFJHF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-ethenoxyethyl)-1,4-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethenoxyethyl)-1,4-dithiane?
The IUPAC name of 2-(1-ethenoxyethyl)-1,4-dithiane (CID 176604272) is 2-(1-ethenoxyethyl)-1,4-dithiane.
What is the SMILES notation for 2-(1-ethenoxyethyl)-1,4-dithiane?
The canonical SMILES for 2-(1-ethenoxyethyl)-1,4-dithiane is C=COC(C)C1CSCCS1.
What is the InChIKey of 2-(1-ethenoxyethyl)-1,4-dithiane?
The InChIKey is OGGLRXPMQIFJHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14OS2/c1-3-9-7(2)8-6-10-4-5-11-8/h3,7-8H,1,4-6H2,2H3.
What are the key properties of 2-(1-ethenoxyethyl)-1,4-dithiane?
2-(1-ethenoxyethyl)-1,4-dithiane has a molecular weight of 190.33 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethenoxyethyl)-1,4-dithiane is sourced from PubChem (CID 176604272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).