C39H42F4O9S2 — CID 176604330
2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenyl]sulfonyloxybenzenesulfonic acid (PubChem CID 176604330) has the molecular formula C39H42F4O9S2 and a molecular weight of 794.88 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenyl]sulfonyloxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenyl]sulfonyloxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176604330 |
| Molecular Formula | C39H42F4O9S2 |
| Molecular Weight | 794.88 g/mol |
| Exact Mass | 794.22 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenyl]sulfonyloxybenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1c(F)c(F)c(OS(=O)(=O)c2c(C3CC4OC3C3CCCC43)cc(C3CC4OC3C3CCCC43)cc2C2CC3OC2C2CCCC32)c(F)c1F |
| InChI | InChI=1S/C39H42F4O9S2/c40-30-32(42)39(53(44,45)46)33(43)31(41)37(30)52-54(47,48)38-25(23-13-28-17-5-2-8-20(17)35(23)50-28)10-15(22-12-27-16-4-1-7-19(16)34(22)49-27)11-26(38)24-14-29-18-6-3-9-21(18)36(24)51-29/h10-11,16-24,27-29,34-36H,1-9,12-14H2,(H,44,45,46) |
| InChIKey | NEFLFADSXOENFI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.88 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|