C9H16O3S2 — CID 176604407
2-[1-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane 1,4-dioxide (PubChem CID 176604407) has the molecular formula C9H16O3S2 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[1-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane 1,4-dioxide.
| Compound Name | 2-[1-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane 1,4-dioxide |
|---|---|
| PubChem CID | 176604407 |
| Molecular Formula | C9H16O3S2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-[1-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane 1,4-dioxide |
| SMILES | C/C=C/OC(C)C1CS(=O)CCS1=O |
| InChI | InChI=1S/C9H16O3S2/c1-3-4-12-8(2)9-7-13(10)5-6-14(9)11/h3-4,8-9H,5-7H2,1-2H3/b4-3+ |
| InChIKey | XDILLSFWONFWTQ-ONEGZZNKSA-N |
| XLogP | 0.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|