C48H53F4O6S2- — CID 176604436
2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)phenyl]sulfonyloxybenzenesulfonate (PubChem CID 176604436) has the molecular formula C48H53F4O6S2- and a molecular weight of 866.07 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)phenyl]sulfonyloxybenzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)phenyl]sulfonyloxybenzenesulfonate |
|---|---|
| PubChem CID | 176604436 |
| Molecular Formula | C48H53F4O6S2- |
| Molecular Weight | 866.07 g/mol |
| Exact Mass | 865.32 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)phenyl]sulfonyloxybenzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(OS(=O)(=O)c2c(C3CC4CC3C3C5CCC(C5)C43)cc(C3CC4CC3C3C5CCC(C5)C43)cc2C2CC3CC2C2C4CCC(C4)C32)c(F)c1F |
| InChI | InChI=1S/C48H54F4O6S2/c49-42-44(51)48(59(53,54)55)45(52)43(50)46(42)58-60(56,57)47-34(29-13-26-16-32(29)40-22-5-2-19(8-22)37(26)40)10-24(28-12-25-15-31(28)39-21-4-1-18(7-21)36(25)39)11-35(47)30-14-27-17-33(30)41-23-6-3-20(9-23)38(27)41/h10-11,18-23,25-33,36-41H,1-9,12-17H2,(H,53,54,55)/p-1 |
| InChIKey | IPFQXZOBHIKYDP-UHFFFAOYSA-M |
| XLogP | 10.27 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.07 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|