C14H24O5S2 — CID 176604727
2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dithiane 1,1,4,4-tetraoxide (PubChem CID 176604727) has the molecular formula C14H24O5S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dithiane 1,1,4,4-tetraoxide.
| Compound Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dithiane 1,1,4,4-tetraoxide |
|---|---|
| PubChem CID | 176604727 |
| Molecular Formula | C14H24O5S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dithiane 1,1,4,4-tetraoxide |
| SMILES | CCC1(COC=C2CCCCC2)CS(=O)(=O)CCS1(=O)=O |
| InChI | InChI=1S/C14H24O5S2/c1-2-14(11-19-10-13-6-4-3-5-7-13)12-20(15,16)8-9-21(14,17)18/h10H,2-9,11-12H2,1H3 |
| InChIKey | XQKZENJMCHJWQV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|