C40H42F4O8S — CID 176604766
2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176604766) has the molecular formula C40H42F4O8S and a molecular weight of 758.83 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176604766 |
| Molecular Formula | C40H42F4O8S |
| Molecular Weight | 758.83 g/mol |
| Exact Mass | 758.25 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2CC3OC2C2CCCC32)cc(C2CC3OC2C2CCCC32)cc1C1CC2OC1C1CCCC21 |
| InChI | InChI=1S/C40H42F4O8S/c41-31-33(43)39(53(46,47)48)34(44)32(42)38(31)52-40(45)30-23(25-13-28-17-5-2-8-20(17)36(25)50-28)10-15(22-12-27-16-4-1-7-19(16)35(22)49-27)11-24(30)26-14-29-18-6-3-9-21(18)37(26)51-29/h10-11,16-22,25-29,35-37H,1-9,12-14H2,(H,46,47,48) |
| InChIKey | IAABDKKLGZAGIH-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.83 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|