C42H41F4O10S- — CID 176604831
2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)phenoxy]benzenesulfonate (PubChem CID 176604831) has the molecular formula C42H41F4O10S- and a molecular weight of 813.84 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)phenoxy]benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)phenoxy]benzenesulfonate |
|---|---|
| PubChem CID | 176604831 |
| Molecular Formula | C42H41F4O10S- |
| Molecular Weight | 813.84 g/mol |
| Exact Mass | 813.24 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)phenoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(Oc2c(C3CC4OC3C3C5CCC(O5)C43)cc(C3CC4OC3C3C5CCC(O5)C43)cc2C2CC3OC2C2C4CCC(O4)C32)c(F)c1F |
| InChI | InChI=1S/C42H42F4O10S/c43-33-35(45)42(57(47,48)49)36(46)34(44)41(33)56-37-14(16-10-25-28-19-2-5-22(51-19)31(28)39(16)54-25)7-12(13-9-24-27-18-1-4-21(50-18)30(27)38(13)53-24)8-15(37)17-11-26-29-20-3-6-23(52-20)32(29)40(17)55-26/h7-8,13,16-32,38-40H,1-6,9-11H2,(H,47,48,49)/p-1 |
| InChIKey | ZELVMPSNALZMMQ-UHFFFAOYSA-M |
| XLogP | 6.08 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.84 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|