C39H41F4O7S- — CID 176604922
2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenoxy]benzenesulfonate (PubChem CID 176604922) has the molecular formula C39H41F4O7S- and a molecular weight of 729.81 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenoxy]benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenoxy]benzenesulfonate |
|---|---|
| PubChem CID | 176604922 |
| Molecular Formula | C39H41F4O7S- |
| Molecular Weight | 729.81 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(10-oxatricyclo[5.2.1.02,6]decan-8-yl)phenoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(Oc2c(C3CC4OC3C3CCCC43)cc(C3CC4OC3C3CCCC43)cc2C2CC3OC2C2CCCC32)c(F)c1F |
| InChI | InChI=1S/C39H42F4O7S/c40-30-32(42)39(51(44,45)46)33(43)31(41)38(30)50-37-23(25-13-28-17-5-2-8-20(17)35(25)48-28)10-15(22-12-27-16-4-1-7-19(16)34(22)47-27)11-24(37)26-14-29-18-6-3-9-21(18)36(26)49-29/h10-11,16-22,25-29,34-36H,1-9,12-14H2,(H,44,45,46)/p-1 |
| InChIKey | CJNLCPWQWOADHN-UHFFFAOYSA-M |
| XLogP | 7.95 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.81 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|