C17H10F2I3O5S- — CID 176605116
2,3-difluoro-4-(2,3,5-triiodobenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonate (PubChem CID 176605116) has the molecular formula C17H10F2I3O5S- and a molecular weight of 745.04 g/mol. Its IUPAC name is 2,3-difluoro-4-(2,3,5-triiodobenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonate.
| Compound Name | 2,3-difluoro-4-(2,3,5-triiodobenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 176605116 |
| Molecular Formula | C17H10F2I3O5S- |
| Molecular Weight | 745.04 g/mol |
| Exact Mass | 744.74 |
| IUPAC Name | 2,3-difluoro-4-(2,3,5-triiodobenzoyl)oxy-5,6,7,8-tetrahydronaphthalene-1-sulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c2c1CCCC2)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C17H11F2I3O5S/c18-12-13(19)16(28(24,25)26)9-4-2-1-3-8(9)15(12)27-17(23)10-5-7(20)6-11(21)14(10)22/h5-6H,1-4H2,(H,24,25,26)/p-1 |
| InChIKey | APJSTYAESJYRNT-UHFFFAOYSA-M |
| XLogP | 4.78 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.04 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|