C30H29F4O4S4- — CID 176605263
2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)phenoxy]benzenesulfonate (PubChem CID 176605263) has the molecular formula C30H29F4O4S4- and a molecular weight of 657.82 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)phenoxy]benzenesulfonate.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)phenoxy]benzenesulfonate |
|---|---|
| PubChem CID | 176605263 |
| Molecular Formula | C30H29F4O4S4- |
| Molecular Weight | 657.82 g/mol |
| Exact Mass | 657.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)phenoxy]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1c(F)c(F)c(Oc2c(C3CC4CCC3S4)cc(C3CC4CCC3S4)cc2C2CC3CCC2S3)c(F)c1F |
| InChI | InChI=1S/C30H30F4O4S4/c31-24-26(33)30(42(35,36)37)27(34)25(32)29(24)38-28-19(17-10-14-2-5-22(17)40-14)7-12(16-9-13-1-4-21(16)39-13)8-20(28)18-11-15-3-6-23(18)41-15/h7-8,13-18,21-23H,1-6,9-11H2,(H,35,36,37)/p-1 |
| InChIKey | ABOZDRCVVNGGIM-UHFFFAOYSA-M |
| XLogP | 8.19 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.82 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|