C22H18Br2F4NO9S- — CID 176607388
4-[3,5-dibromo-4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 176607388) has the molecular formula C22H18Br2F4NO9S- and a molecular weight of 708.25 g/mol. Its IUPAC name is 4-[3,5-dibromo-4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[3,5-dibromo-4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 176607388 |
| Molecular Formula | C22H18Br2F4NO9S- |
| Molecular Weight | 708.25 g/mol |
| Exact Mass | 705.90 |
| IUPAC Name | 4-[3,5-dibromo-4-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyloxy]benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)Oc1c(Br)cc(C(=O)Oc2c(F)c(F)c(S(=O)(=O)[O-])c(F)c2F)cc1Br |
| InChI | InChI=1S/C22H19Br2F4NO9S/c1-4-22(2,3)20(31)36-6-5-29-21(32)38-16-10(23)7-9(8-11(16)24)19(30)37-17-12(25)14(27)18(39(33,34)35)15(28)13(17)26/h7-8H,4-6H2,1-3H3,(H,29,32)(H,33,34,35)/p-1 |
| InChIKey | RGWHFHSKCBQCGA-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 148.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.25 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|