C30H18ClNO — CID 176608666
9-[3-(1-chloro-2,3,6,7,8,9-hexadeuteriodibenzofuran-4-yl)-2,4,5,6-tetradeuteriophenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole (PubChem CID 176608666) has the molecular formula C30H18ClNO and a molecular weight of 462.04 g/mol. Its IUPAC name is 9-[3-(1-chloro-2,3,6,7,8,9-hexadeuteriodibenzofuran-4-yl)-2,4,5,6-tetradeuteriophenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole.
| Compound Name | 9-[3-(1-chloro-2,3,6,7,8,9-hexadeuteriodibenzofuran-4-yl)-2,4,5,6-tetradeuteriophenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
|---|---|
| PubChem CID | 176608666 |
| Molecular Formula | C30H18ClNO |
| Molecular Weight | 462.04 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 9-[3-(1-chloro-2,3,6,7,8,9-hexadeuteriodibenzofuran-4-yl)-2,4,5,6-tetradeuteriophenyl]-1,2,3,4,5,6,7,8-octadeuteriocarbazole |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c(Cl)c3c2oc2c([2H])c([2H])c([2H])c([2H])c23)c([2H])c(-n2c3c([2H])c([2H])c([2H])c([2H])c3c3c([2H])c([2H])c([2H])c([2H])c32)c1[2H] |
| InChI | InChI=1S/C30H18ClNO/c31-25-17-16-21(30-29(25)24-12-3-6-15-28(24)33-30)19-8-7-9-20(18-19)32-26-13-4-1-10-22(26)23-11-2-5-14-27(23)32/h1-18H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D,17D,18D |
| InChIKey | ZCHXNNGAERZFJF-QICNJPGCSA-N |
| XLogP | 9.00 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.04 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |