About [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol
[3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol (PubChem CID 176610381) has the molecular formula C19H42O7Si2
and a molecular weight of 438.71 g/mol. Its IUPAC name is [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol |
| PubChem CID | 176610381 |
| Molecular Formula | C19H42O7Si2 |
| Molecular Weight | 438.71 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol |
| SMILES | CO[Si](CCCC1CC(CO)CC(CCC[Si](OC)(OC)OC)C1)(OC)OC |
| InChI | InChI=1S/C19H42O7Si2/c1-21-27(22-2,23-3)11-7-9-17-13-18(15-19(14-17)16-20)10-8-12-28(24-4,25-5)26-6/h17-20H,7-16H2,1-6H3 |
| InChIKey | AIJKFVQYCFJFLC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.71 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol?
The IUPAC name of [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol (CID 176610381) is [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol.
What is the SMILES notation for [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol?
The canonical SMILES for [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol is CO[Si](CCCC1CC(CO)CC(CCC[Si](OC)(OC)OC)C1)(OC)OC.
What is the InChIKey of [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol?
The InChIKey is AIJKFVQYCFJFLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H42O7Si2/c1-21-27(22-2,23-3)11-7-9-17-13-18(15-19(14-17)16-20)10-8-12-28(24-4,25-5)26-6/h17-20H,7-16H2,1-6H3.
What are the key properties of [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol?
[3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol has a molecular weight of 438.71 g/mol, XLogP of 3.33, 15 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(3-trimethoxysilylpropyl)cyclohexyl]methanol is sourced from PubChem (CID 176610381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).