C20H22ClN5O3 — CID 176610447
4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-N-[(1S)-2-hydroxy-1-(6-oxo-1H-pyridin-3-yl)ethyl]-1H-pyrrole-2-carboxamide (PubChem CID 176610447) has the molecular formula C20H22ClN5O3 and a molecular weight of 422.92 g/mol. Its IUPAC name is 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-N-[(1S)-2-hydroxy-1-(6-oxo-1H-pyridin-3-yl)ethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-N-[(1S)-2-hydroxy-1-(6-oxo-1H-pyridin-3-yl)ethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 176610447 |
| Molecular Formula | C20H22ClN5O3 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-[5-chloro-2-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-4-pyridinyl]-N-[(1S)-2-hydroxy-1-(6-oxo-1H-pyridin-3-yl)ethyl]-1H-pyrrole-2-carboxamide |
| SMILES | [2H]C([2H])([2H])C([2H])(Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3ccc(=O)[nH]c3)c2)c(Cl)cn1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H22ClN5O3/c1-11(2)25-18-6-14(15(21)9-23-18)13-5-16(22-8-13)20(29)26-17(10-27)12-3-4-19(28)24-7-12/h3-9,11,17,22,27H,10H2,1-2H3,(H,23,25)(H,24,28)(H,26,29)/t17-/m1/s1/i1D3,2D3,11D |
| InChIKey | SLVZMYCLKJZHLS-WGWNNFLISA-N |
| XLogP | 2.70 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |