C50H57N5O5 — CID 176610537
methyl 5-(2,6-dimethoxyphenyl)-1-[4-[methyl-[3-[methyl-[3-(tritylamino)propyl]amino]propyl]carbamoyl]-2-propan-2-ylphenyl]pyrazole-3-carboxylate (PubChem CID 176610537) has the molecular formula C50H57N5O5 and a molecular weight of 808.04 g/mol. Its IUPAC name is methyl 5-(2,6-dimethoxyphenyl)-1-[4-[methyl-[3-[methyl-[3-(tritylamino)propyl]amino]propyl]carbamoyl]-2-propan-2-ylphenyl]pyrazole-3-carboxylate.
| Compound Name | methyl 5-(2,6-dimethoxyphenyl)-1-[4-[methyl-[3-[methyl-[3-(tritylamino)propyl]amino]propyl]carbamoyl]-2-propan-2-ylphenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 176610537 |
| Molecular Formula | C50H57N5O5 |
| Molecular Weight | 808.04 g/mol |
| Exact Mass | 807.44 |
| IUPAC Name | methyl 5-(2,6-dimethoxyphenyl)-1-[4-[methyl-[3-[methyl-[3-(tritylamino)propyl]amino]propyl]carbamoyl]-2-propan-2-ylphenyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2c(OC)cccc2OC)n(-c2ccc(C(=O)N(C)CCCN(C)CCCNC(c3ccccc3)(c3ccccc3)c3ccccc3)cc2C(C)C)n1 |
| InChI | InChI=1S/C50H57N5O5/c1-36(2)41-34-37(28-29-43(41)55-44(35-42(52-55)49(57)60-7)47-45(58-5)26-17-27-46(47)59-6)48(56)54(4)33-19-32-53(3)31-18-30-51-50(38-20-11-8-12-21-38,39-22-13-9-14-23-39)40-24-15-10-16-25-40/h8-17,20-29,34-36,51H,18-19,30-33H2,1-7H3 |
| InChIKey | KPQAZTQMPCNHPE-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.04 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|