About 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene
6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene (PubChem CID 176611106) has the molecular formula C15H24S
and a molecular weight of 236.42 g/mol. Its IUPAC name is 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene.
Molecular Properties
| Compound Name | 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene |
| PubChem CID | 176611106 |
| Molecular Formula | C15H24S |
| Molecular Weight | 236.42 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCc2ccsc21 |
| InChI | InChI=1S/C15H24S/c1-13(2,3)15(14(4,5)6)9-7-11-8-10-16-12(11)15/h8,10H,7,9H2,1-6H3 |
| InChIKey | YTFWTFJBPJEWGC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.42 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene?
The IUPAC name of 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene (CID 176611106) is 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene.
What is the SMILES notation for 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene?
The canonical SMILES for 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene is CC(C)(C)C1(C(C)(C)C)CCc2ccsc21.
What is the InChIKey of 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene?
The InChIKey is YTFWTFJBPJEWGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24S/c1-13(2,3)15(14(4,5)6)9-7-11-8-10-16-12(11)15/h8,10H,7,9H2,1-6H3.
What are the key properties of 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene?
6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene has a molecular weight of 236.42 g/mol, XLogP of 5.02, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-ditert-butyl-4,5-dihydrocyclopenta[b]thiophene is sourced from PubChem (CID 176611106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).