About (3-amino-3-methylbutyl) decyl sulfate
(3-amino-3-methylbutyl) decyl sulfate (PubChem CID 176611633) has the molecular formula C15H33NO4S
and a molecular weight of 323.50 g/mol. Its IUPAC name is (3-amino-3-methylbutyl) decyl sulfate.
Molecular Properties
| Compound Name | (3-amino-3-methylbutyl) decyl sulfate |
| PubChem CID | 176611633 |
| Molecular Formula | C15H33NO4S |
| Molecular Weight | 323.50 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (3-amino-3-methylbutyl) decyl sulfate |
| SMILES | CCCCCCCCCCOS(=O)(=O)OCCC(C)(C)N |
| InChI | InChI=1S/C15H33NO4S/c1-4-5-6-7-8-9-10-11-13-19-21(17,18)20-14-12-15(2,3)16/h4-14,16H2,1-3H3 |
| InChIKey | OPDYRVSVDUFXGR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3-amino-3-methylbutyl) decyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-3-methylbutyl) decyl sulfate?
The IUPAC name of (3-amino-3-methylbutyl) decyl sulfate (CID 176611633) is (3-amino-3-methylbutyl) decyl sulfate.
What is the SMILES notation for (3-amino-3-methylbutyl) decyl sulfate?
The canonical SMILES for (3-amino-3-methylbutyl) decyl sulfate is CCCCCCCCCCOS(=O)(=O)OCCC(C)(C)N.
What is the InChIKey of (3-amino-3-methylbutyl) decyl sulfate?
The InChIKey is OPDYRVSVDUFXGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33NO4S/c1-4-5-6-7-8-9-10-11-13-19-21(17,18)20-14-12-15(2,3)16/h4-14,16H2,1-3H3.
What are the key properties of (3-amino-3-methylbutyl) decyl sulfate?
(3-amino-3-methylbutyl) decyl sulfate has a molecular weight of 323.50 g/mol, XLogP of 3.53, 14 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-3-methylbutyl) decyl sulfate is sourced from PubChem (CID 176611633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).