About (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol
(4R)-1-tert-butyl-5,5-difluoroazepan-4-ol (PubChem CID 176612686) has the molecular formula C10H19F2NO
and a molecular weight of 207.26 g/mol. Its IUPAC name is (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol.
Molecular Properties
| Compound Name | (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol |
| PubChem CID | 176612686 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol |
| SMILES | CC(C)(C)N1CC[C@@H](O)C(F)(F)CC1 |
| InChI | InChI=1S/C10H19F2NO/c1-9(2,3)13-6-4-8(14)10(11,12)5-7-13/h8,14H,4-7H2,1-3H3/t8-/m1/s1 |
| InChIKey | GSCDXIMKDGFBGK-MRVPVSSYSA-N |
| XLogP | 1.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol?
The IUPAC name of (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol (CID 176612686) is (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol.
What is the SMILES notation for (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol?
The canonical SMILES for (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol is CC(C)(C)N1CC[C@@H](O)C(F)(F)CC1.
What is the InChIKey of (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol?
The InChIKey is GSCDXIMKDGFBGK-MRVPVSSYSA-N. The full InChI is InChI=1S/C10H19F2NO/c1-9(2,3)13-6-4-8(14)10(11,12)5-7-13/h8,14H,4-7H2,1-3H3/t8-/m1/s1.
What are the key properties of (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol?
(4R)-1-tert-butyl-5,5-difluoroazepan-4-ol has a molecular weight of 207.26 g/mol, XLogP of 1.88, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-tert-butyl-5,5-difluoroazepan-4-ol is sourced from PubChem (CID 176612686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).