C15H28N2O — CID 176612713
(2S,3R,4R,5R)-3-ethynyl-3-N,4-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine (PubChem CID 176612713) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3-ethynyl-3-N,4-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine.
| Compound Name | (2S,3R,4R,5R)-3-ethynyl-3-N,4-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
|---|---|
| PubChem CID | 176612713 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (2S,3R,4R,5R)-3-ethynyl-3-N,4-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
| SMILES | C#C[C@]1(NC)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC |
| InChI | InChI=1S/C15H28N2O/c1-8-15(17-7)13(16-6)12(9-10(2)3)18-14(15)11(4)5/h1,10-14,16-17H,9H2,2-7H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | AEEHKGJXIWWJME-CBBWQLFWSA-N |
| XLogP | 1.64 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|