C17H34N2O — CID 176612720
(2S,3R,4S,5R)-3-ethenyl-3-N,3-N,4-N,4-N-tetramethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine (PubChem CID 176612720) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3-ethenyl-3-N,3-N,4-N,4-N-tetramethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine.
| Compound Name | (2S,3R,4S,5R)-3-ethenyl-3-N,3-N,4-N,4-N-tetramethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
|---|---|
| PubChem CID | 176612720 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | (2S,3R,4S,5R)-3-ethenyl-3-N,3-N,4-N,4-N-tetramethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
| SMILES | C=C[C@]1(N(C)C)[C@H](C(C)C)O[C@H](CC(C)C)[C@H]1N(C)C |
| InChI | InChI=1S/C17H34N2O/c1-10-17(19(8)9)15(18(6)7)14(11-12(2)3)20-16(17)13(4)5/h10,12-16H,1,11H2,2-9H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | AKBZELKMIIHNGU-WCXIOVBPSA-N |
| XLogP | 2.87 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|