C14H28N2O — CID 176612802
(2S,3R,4R,5R)-3-ethenyl-4-N-methyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine (PubChem CID 176612802) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is (2S,3R,4R,5R)-3-ethenyl-4-N-methyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine.
| Compound Name | (2S,3R,4R,5R)-3-ethenyl-4-N-methyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
|---|---|
| PubChem CID | 176612802 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | (2S,3R,4R,5R)-3-ethenyl-4-N-methyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
| SMILES | C=C[C@]1(N)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC |
| InChI | InChI=1S/C14H28N2O/c1-7-14(15)12(16-6)11(8-9(2)3)17-13(14)10(4)5/h7,9-13,16H,1,8,15H2,2-6H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | MIBNSUSWNMCCDI-ZOBORPQBSA-N |
| XLogP | 1.93 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|