C17H30N2O3 — CID 176612838
N-[(2R,3R,4R,5S)-4-acetamido-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide (PubChem CID 176612838) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is N-[(2R,3R,4R,5S)-4-acetamido-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide.
| Compound Name | N-[(2R,3R,4R,5S)-4-acetamido-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 176612838 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | N-[(2R,3R,4R,5S)-4-acetamido-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide |
| SMILES | C=C[C@]1(NC(C)=O)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C17H30N2O3/c1-8-17(19-13(7)21)15(18-12(6)20)14(9-10(2)3)22-16(17)11(4)5/h8,10-11,14-16H,1,9H2,2-7H3,(H,18,20)(H,19,21)/t14-,15+,16+,17-/m1/s1 |
| InChIKey | OMSRNOFNYNUPMG-LTIDMASMSA-N |
| XLogP | 2.02 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|