C15H28FNO — CID 176612871
(2R,3R,4R,5S)-4-ethenyl-4-fluoro-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine (PubChem CID 176612871) has the molecular formula C15H28FNO and a molecular weight of 257.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-ethenyl-4-fluoro-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3R,4R,5S)-4-ethenyl-4-fluoro-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176612871 |
| Molecular Formula | C15H28FNO |
| Molecular Weight | 257.39 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | (2R,3R,4R,5S)-4-ethenyl-4-fluoro-N,N-dimethyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
| SMILES | C=C[C@]1(F)[C@H](C(C)C)O[C@H](CC(C)C)[C@H]1N(C)C |
| InChI | InChI=1S/C15H28FNO/c1-8-15(16)13(17(6)7)12(9-10(2)3)18-14(15)11(4)5/h8,10-14H,1,9H2,2-7H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | VFQBNMRFKVEUNN-APIJFGDWSA-N |
| XLogP | 3.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|