C15H24FNO2 — CID 176612931
N-[(2R,3S,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide (PubChem CID 176612931) has the molecular formula C15H24FNO2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-[(2R,3S,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide.
| Compound Name | N-[(2R,3S,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 176612931 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | N-[(2R,3S,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl]acetamide |
| SMILES | C#C[C@]1(F)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C15H24FNO2/c1-7-15(16)13(17-11(6)18)12(8-9(2)3)19-14(15)10(4)5/h1,9-10,12-14H,8H2,2-6H3,(H,17,18)/t12-,13+,14+,15-/m1/s1 |
| InChIKey | PDBABHSEXQCNAJ-CBBWQLFWSA-N |
| XLogP | 2.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|