C15H30N2O — CID 176612946
(2S,3R,4S,5R)-3-ethenyl-3-N,3-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine (PubChem CID 176612946) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3-ethenyl-3-N,3-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine.
| Compound Name | (2S,3R,4S,5R)-3-ethenyl-3-N,3-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
|---|---|
| PubChem CID | 176612946 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | (2S,3R,4S,5R)-3-ethenyl-3-N,3-N-dimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
| SMILES | C=C[C@@]1(N(C)C)[C@H](N)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C15H30N2O/c1-8-15(17(6)7)13(16)12(9-10(2)3)18-14(15)11(4)5/h8,10-14H,1,9,16H2,2-7H3/t12-,13-,14+,15-/m1/s1 |
| InChIKey | LHWKZKXLJXLERT-APIJFGDWSA-N |
| XLogP | 2.27 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|