C16H32N2O — CID 176612955
(2S,3R,4S,5R)-3-ethenyl-3-N,4-N,4-N-trimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine (PubChem CID 176612955) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is (2S,3R,4S,5R)-3-ethenyl-3-N,4-N,4-N-trimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine.
| Compound Name | (2S,3R,4S,5R)-3-ethenyl-3-N,4-N,4-N-trimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
|---|---|
| PubChem CID | 176612955 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | (2S,3R,4S,5R)-3-ethenyl-3-N,4-N,4-N-trimethyl-5-(2-methylpropyl)-2-propan-2-yloxolane-3,4-diamine |
| SMILES | C=C[C@]1(NC)[C@H](C(C)C)O[C@H](CC(C)C)[C@H]1N(C)C |
| InChI | InChI=1S/C16H32N2O/c1-9-16(17-6)14(18(7)8)13(10-11(2)3)19-15(16)12(4)5/h9,11-15,17H,1,10H2,2-8H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | GIHLDOAMGPJPEY-LVQVYYBASA-N |
| XLogP | 2.53 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|