C15H25ClO3 — CID 176612957
[(2R,3R,4S,5S)-4-chloro-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate (PubChem CID 176612957) has the molecular formula C15H25ClO3 and a molecular weight of 288.82 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-4-chloro-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S)-4-chloro-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate |
|---|---|
| PubChem CID | 176612957 |
| Molecular Formula | C15H25ClO3 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [(2R,3R,4S,5S)-4-chloro-4-ethenyl-2-(2-methylpropyl)-5-propan-2-yloxolan-3-yl] acetate |
| SMILES | C=C[C@@]1(Cl)[C@H](OC(C)=O)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C15H25ClO3/c1-7-15(16)13(10(4)5)19-12(8-9(2)3)14(15)18-11(6)17/h7,9-10,12-14H,1,8H2,2-6H3/t12-,13+,14-,15+/m1/s1 |
| InChIKey | QWNGLKSWWZGVIJ-BARDWOONSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|