C13H22FNO — CID 176613001
(2R,3R,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine (PubChem CID 176613001) has the molecular formula C13H22FNO and a molecular weight of 227.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3R,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176613001 |
| Molecular Formula | C13H22FNO |
| Molecular Weight | 227.32 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2R,3R,4R,5S)-4-ethynyl-4-fluoro-2-(2-methylpropyl)-5-propan-2-yloxolan-3-amine |
| SMILES | C#C[C@@]1(F)[C@H](N)[C@@H](CC(C)C)O[C@H]1C(C)C |
| InChI | InChI=1S/C13H22FNO/c1-6-13(14)11(15)10(7-8(2)3)16-12(13)9(4)5/h1,8-12H,7,15H2,2-5H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | MKFNZWRSTMBIGI-FVCCEPFGSA-N |
| XLogP | 2.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|