C15H26ClNO — CID 176613225
(2R,3S,4R,5S)-4-chloro-N-methyl-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine (PubChem CID 176613225) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is (2R,3S,4R,5S)-4-chloro-N-methyl-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine.
| Compound Name | (2R,3S,4R,5S)-4-chloro-N-methyl-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine |
|---|---|
| PubChem CID | 176613225 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2R,3S,4R,5S)-4-chloro-N-methyl-2-(2-methylpropyl)-4-propa-1,2-dienyl-5-propan-2-yloxolan-3-amine |
| SMILES | C=C=C[C@]1(Cl)[C@H](C(C)C)O[C@H](CC(C)C)[C@@H]1NC |
| InChI | InChI=1S/C15H26ClNO/c1-7-8-15(16)13(17-6)12(9-10(2)3)18-14(15)11(4)5/h8,10-14,17H,1,9H2,2-6H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | MHZZZWRKLHZINC-CBBWQLFWSA-N |
| XLogP | 3.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|