C27H31FN6S — CID 176613843
N-[[(1S,3S)-3-aminocyclohexyl]methyl]-5-(3-fluoro-4-isocyanophenyl)-1-(4-thiomorpholin-4-ylphenyl)pyrazol-3-amine (PubChem CID 176613843) has the molecular formula C27H31FN6S and a molecular weight of 490.65 g/mol. Its IUPAC name is N-[[(1S,3S)-3-aminocyclohexyl]methyl]-5-(3-fluoro-4-isocyanophenyl)-1-(4-thiomorpholin-4-ylphenyl)pyrazol-3-amine.
| Compound Name | N-[[(1S,3S)-3-aminocyclohexyl]methyl]-5-(3-fluoro-4-isocyanophenyl)-1-(4-thiomorpholin-4-ylphenyl)pyrazol-3-amine |
|---|---|
| PubChem CID | 176613843 |
| Molecular Formula | C27H31FN6S |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | N-[[(1S,3S)-3-aminocyclohexyl]methyl]-5-(3-fluoro-4-isocyanophenyl)-1-(4-thiomorpholin-4-ylphenyl)pyrazol-3-amine |
| SMILES | [C-]#[N+]c1ccc(-c2cc(NC[C@H]3CCC[C@H](N)C3)nn2-c2ccc(N3CCSCC3)cc2)cc1F |
| InChI | InChI=1S/C27H31FN6S/c1-30-25-10-5-20(16-24(25)28)26-17-27(31-18-19-3-2-4-21(29)15-19)32-34(26)23-8-6-22(7-9-23)33-11-13-35-14-12-33/h5-10,16-17,19,21H,2-4,11-15,18,29H2,(H,31,32)/t19-,21-/m0/s1 |
| InChIKey | KOVDDVZTSHNTSQ-FPOVZHCZSA-N |
| XLogP | 5.71 |
| TPSA | 63.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|