About 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide
3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide (PubChem CID 176613905) has the molecular formula C18H12BrIN4O3S
and a molecular weight of 571.19 g/mol. Its IUPAC name is 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide |
| PubChem CID | 176613905 |
| Molecular Formula | C18H12BrIN4O3S |
| Molecular Weight | 571.19 g/mol |
| Exact Mass | 569.89 |
| IUPAC Name | 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide |
| SMILES | O=S1(=O)CC(n2cc(-c3ncnc4oc(Br)cc34)c(-c3ccc(I)cc3)n2)C1 |
| InChI | InChI=1S/C18H12BrIN4O3S/c19-15-5-13-17(21-9-22-18(13)27-15)14-6-24(12-7-28(25,26)8-12)23-16(14)10-1-3-11(20)4-2-10/h1-6,9,12H,7-8H2 |
| InChIKey | WVAMORZQYGPTHB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 90.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 571.19 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide?
The IUPAC name of 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide (CID 176613905) is 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide.
What is the SMILES notation for 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide?
The canonical SMILES for 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide is O=S1(=O)CC(n2cc(-c3ncnc4oc(Br)cc34)c(-c3ccc(I)cc3)n2)C1.
What is the InChIKey of 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide?
The InChIKey is WVAMORZQYGPTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrIN4O3S/c19-15-5-13-17(21-9-22-18(13)27-15)14-6-24(12-7-28(25,26)8-12)23-16(14)10-1-3-11(20)4-2-10/h1-6,9,12H,7-8H2.
What are the key properties of 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide?
3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide has a molecular weight of 571.19 g/mol, XLogP of 4.09, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(6-bromofuro[2,3-d]pyrimidin-4-yl)-3-(4-iodophenyl)pyrazol-1-yl]thietane 1,1-dioxide is sourced from PubChem (CID 176613905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).