C10H16F4O2 — CID 176614512
2,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-3-one (PubChem CID 176614512) has the molecular formula C10H16F4O2 and a molecular weight of 244.23 g/mol. Its IUPAC name is 2,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-3-one.
| Compound Name | 2,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-3-one |
|---|---|
| PubChem CID | 176614512 |
| Molecular Formula | C10H16F4O2 |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2,4-dimethyl-2-(2,2,3,3-tetrafluoropropoxy)pentan-3-one |
| SMILES | CC(C)C(=O)C(C)(C)OCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4O2/c1-6(2)7(15)9(3,4)16-5-10(13,14)8(11)12/h6,8H,5H2,1-4H3 |
| InChIKey | OFHNSZYXWGDVJB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|