C12H10FN3O2S — CID 176617331
2-[(1S,2S)-2-fluorocyclopropyl]-5-(4-methyl-3-nitrophenyl)-1,3,4-thiadiazole (PubChem CID 176617331) has the molecular formula C12H10FN3O2S and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-[(1S,2S)-2-fluorocyclopropyl]-5-(4-methyl-3-nitrophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-[(1S,2S)-2-fluorocyclopropyl]-5-(4-methyl-3-nitrophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 176617331 |
| Molecular Formula | C12H10FN3O2S |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[(1S,2S)-2-fluorocyclopropyl]-5-(4-methyl-3-nitrophenyl)-1,3,4-thiadiazole |
| SMILES | Cc1ccc(-c2nnc([C@H]3C[C@@H]3F)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10FN3O2S/c1-6-2-3-7(4-10(6)16(17)18)11-14-15-12(19-11)8-5-9(8)13/h2-4,8-9H,5H2,1H3/t8-,9-/m0/s1 |
| InChIKey | OZTSJCXWPXOQMY-IUCAKERBSA-N |
| XLogP | 3.25 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|