About CID 176617836
CID 176617836 (PubChem CID 176617836) has the molecular formula C65H52F3IrN3O-2
and a molecular weight of 1140.36 g/mol.
Molecular Properties
| Compound Name | CID 176617836 |
| PubChem CID | 176617836 |
| Molecular Formula | C65H52F3IrN3O-2 |
| Molecular Weight | 1140.36 g/mol |
| Exact Mass | 1140.37 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cc3oc4cc5cc(C(F)(F)F)c6ccccc6c5cc4c3c2)nc2ccc3ccccc3c21.[Ir] |
| InChI | InChI=1S/C50H36F3N2O.C15H16N.Ir/c1-28(2)38-23-33(30-12-6-5-7-13-30)24-39(29(3)4)47(38)55-48-35-15-9-8-14-31(35)18-20-44(48)54-49(55)32-19-21-45-41(22-32)42-27-40-34(26-46(42)56-45)25-43(50(51,52)53)37-17-11-10-16-36(37)40;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h5-18,20-29H,1-4H3;4-7,9-11H,1-3H3;/q2*-1; |
| InChIKey | OAXLJPDDMWTVCE-UHFFFAOYSA-N |
| XLogP | 18.63 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 73 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1140.36 |
| LogP ≤ 5 | 18.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze CID 176617836 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176617836?
The IUPAC name of CID 176617836 (CID 176617836) is not available.
What is the SMILES notation for CID 176617836?
The canonical SMILES for CID 176617836 is CC(C)(C)c1ccnc(-c2[c-]cccc2)c1.CC(C)c1cc(-c2ccccc2)cc(C(C)C)c1-n1c(-c2[c-]cc3oc4cc5cc(C(F)(F)F)c6ccccc6c5cc4c3c2)nc2ccc3ccccc3c21.[Ir].
What is the InChIKey of CID 176617836?
The InChIKey is OAXLJPDDMWTVCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H36F3N2O.C15H16N.Ir/c1-28(2)38-23-33(30-12-6-5-7-13-30)24-39(29(3)4)47(38)55-48-35-15-9-8-14-31(35)18-20-44(48)54-49(55)32-19-21-45-41(22-32)42-27-40-34(26-46(42)56-45)25-43(50(51,52)53)37-17-11-10-16-36(37)40;1-15(2,3)13-9-10-16-14(11-13)12-7-5-4-6-8-12;/h5-18,20-29H,1-4H3;4-7,9-11H,1-3H3;/q2*-1;.
What are the key properties of CID 176617836?
CID 176617836 has a molecular weight of 1140.36 g/mol, XLogP of 18.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176617836 is sourced from PubChem (CID 176617836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).