About CID 176618230
CID 176618230 (PubChem CID 176618230) has the molecular formula C27H19NO5
and a molecular weight of 437.45 g/mol.
Molecular Properties
| Compound Name | CID 176618230 |
| PubChem CID | 176618230 |
| Molecular Formula | C27H19NO5 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | — |
| SMILES | COc1ccc(C(=O)c2cc3cc(N4C(=O)[C]5[C](C4=O)[C@@H]4C=C[C@H]5C5CC54)ccc3o2)cc1 |
| InChI | InChI=1S/C27H19NO5/c1-32-16-5-2-13(3-6-16)25(29)22-11-14-10-15(4-9-21(14)33-22)28-26(30)23-17-7-8-18(20-12-19(17)20)24(23)27(28)31/h2-11,17-20H,12H2,1H3/t17-,18+,19?,20? |
| InChIKey | OMLYJYWUETYSIS-VCWRXUFXSA-N |
| XLogP | 4.15 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze CID 176618230 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176618230?
The IUPAC name of CID 176618230 (CID 176618230) is not available.
What is the SMILES notation for CID 176618230?
The canonical SMILES for CID 176618230 is COc1ccc(C(=O)c2cc3cc(N4C(=O)[C]5[C](C4=O)[C@@H]4C=C[C@H]5C5CC54)ccc3o2)cc1.
What is the InChIKey of CID 176618230?
The InChIKey is OMLYJYWUETYSIS-VCWRXUFXSA-N. The full InChI is InChI=1S/C27H19NO5/c1-32-16-5-2-13(3-6-16)25(29)22-11-14-10-15(4-9-21(14)33-22)28-26(30)23-17-7-8-18(20-12-19(17)20)24(23)27(28)31/h2-11,17-20H,12H2,1H3/t17-,18+,19?,20?.
What are the key properties of CID 176618230?
CID 176618230 has a molecular weight of 437.45 g/mol, XLogP of 4.15, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176618230 is sourced from PubChem (CID 176618230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).