About 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one
1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one (PubChem CID 176618456) has the molecular formula C18H21F2N5O
and a molecular weight of 361.40 g/mol. Its IUPAC name is 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one |
| PubChem CID | 176618456 |
| Molecular Formula | C18H21F2N5O |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CC1CCN(c2c(F)cc(-c3cn[nH]n3)cc2F)CC1 |
| InChI | InChI=1S/C18H21F2N5O/c19-14-8-13(16-10-21-23-22-16)9-15(20)18(14)24-6-3-12(4-7-24)11-25-5-1-2-17(25)26/h8-10,12H,1-7,11H2,(H,21,22,23) |
| InChIKey | RNALWHPJIMYUOT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one?
The IUPAC name of 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one (CID 176618456) is 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one?
The canonical SMILES for 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one is O=C1CCCN1CC1CCN(c2c(F)cc(-c3cn[nH]n3)cc2F)CC1.
What is the InChIKey of 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one?
The InChIKey is RNALWHPJIMYUOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21F2N5O/c19-14-8-13(16-10-21-23-22-16)9-15(20)18(14)24-6-3-12(4-7-24)11-25-5-1-2-17(25)26/h8-10,12H,1-7,11H2,(H,21,22,23).
What are the key properties of 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one?
1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one has a molecular weight of 361.40 g/mol, XLogP of 2.59, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[2,6-difluoro-4-(2H-triazol-4-yl)phenyl]piperidin-4-yl]methyl]pyrrolidin-2-one is sourced from PubChem (CID 176618456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).