C22H20ClF4N3O3 — CID 176618798
(2S,4R)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-4-hydroxy-2-(1,1,1-trifluoropropan-2-yl)pyrrolidine-1-carboxamide (PubChem CID 176618798) has the molecular formula C22H20ClF4N3O3 and a molecular weight of 485.87 g/mol. Its IUPAC name is (2S,4R)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-4-hydroxy-2-(1,1,1-trifluoropropan-2-yl)pyrrolidine-1-carboxamide.
| Compound Name | (2S,4R)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-4-hydroxy-2-(1,1,1-trifluoropropan-2-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 176618798 |
| Molecular Formula | C22H20ClF4N3O3 |
| Molecular Weight | 485.87 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | (2S,4R)-N-[3-(2-chloro-5-fluorophenyl)-1-oxo-2,3-dihydroisoindol-4-yl]-4-hydroxy-2-(1,1,1-trifluoropropan-2-yl)pyrrolidine-1-carboxamide |
| SMILES | CC([C@@H]1C[C@@H](O)CN1C(=O)Nc1cccc2c1C(c1cc(F)ccc1Cl)NC2=O)C(F)(F)F |
| InChI | InChI=1S/C22H20ClF4N3O3/c1-10(22(25,26)27)17-8-12(31)9-30(17)21(33)28-16-4-2-3-13-18(16)19(29-20(13)32)14-7-11(24)5-6-15(14)23/h2-7,10,12,17,19,31H,8-9H2,1H3,(H,28,33)(H,29,32)/t10?,12-,17+,19?/m1/s1 |
| InChIKey | MTJQYEVUSBAYOY-QEEURVETSA-N |
| XLogP | 4.48 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.87 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |