C26H13ClF5N7O2 — CID 176619574
N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[5,1-f][1,2,4]triazin-6-yl)-2,3-dihydroisoindol-4-yl]-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 176619574) has the molecular formula C26H13ClF5N7O2 and a molecular weight of 585.88 g/mol. Its IUPAC name is N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[5,1-f][1,2,4]triazin-6-yl)-2,3-dihydroisoindol-4-yl]-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[5,1-f][1,2,4]triazin-6-yl)-2,3-dihydroisoindol-4-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 176619574 |
| Molecular Formula | C26H13ClF5N7O2 |
| Molecular Weight | 585.88 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | N-[3-(2-chloro-5-fluorophenyl)-1-oxo-6-([1,2,4]triazolo[5,1-f][1,2,4]triazin-6-yl)-2,3-dihydroisoindol-4-yl]-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cc(-c2ncc3ncnn3n2)cc2c1C(c1cc(F)ccc1Cl)NC2=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C26H13ClF5N7O2/c27-18-2-1-14(28)8-16(18)22-21-17(25(41)37-22)5-11(23-33-9-20-34-10-35-39(20)38-23)6-19(21)36-24(40)12-3-13(26(30,31)32)7-15(29)4-12/h1-10,22H,(H,36,40)(H,37,41) |
| InChIKey | ZNZMHEMTISKLBU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 114.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |