C15H13F3N6O2S2 — CID 176620609
(2,2,2-trifluoroethanimidoyl) 5-[(1-cyanocyclopropyl)sulfamoyl]-1-methylindazole-3-carboximidothioate (PubChem CID 176620609) has the molecular formula C15H13F3N6O2S2 and a molecular weight of 430.44 g/mol. Its IUPAC name is (2,2,2-trifluoroethanimidoyl) 5-[(1-cyanocyclopropyl)sulfamoyl]-1-methylindazole-3-carboximidothioate.
| Compound Name | (2,2,2-trifluoroethanimidoyl) 5-[(1-cyanocyclopropyl)sulfamoyl]-1-methylindazole-3-carboximidothioate |
|---|---|
| PubChem CID | 176620609 |
| Molecular Formula | C15H13F3N6O2S2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | (2,2,2-trifluoroethanimidoyl) 5-[(1-cyanocyclopropyl)sulfamoyl]-1-methylindazole-3-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])C(F)(F)F)c1nn(C)c2ccc(S(=O)(=O)NC3(C#N)CC3)cc12 |
| InChI | InChI=1S/C15H13F3N6O2S2/c1-24-10-3-2-8(28(25,26)23-14(7-19)4-5-14)6-9(10)11(22-24)12(20)27-13(21)15(16,17)18/h2-3,6,20-21,23H,4-5H2,1H3/b20-12-,21-13+ |
| InChIKey | RSUKYYMZYHYOCC-AYRZQKSOSA-N |
| XLogP | 2.51 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|