C9H12F5NO5S2 — CID 176620615
(3,3-difluoro-1-propan-2-ylsulfonyl-2,6-dihydropyridin-4-yl) trifluoromethanesulfonate (PubChem CID 176620615) has the molecular formula C9H12F5NO5S2 and a molecular weight of 373.32 g/mol. Its IUPAC name is (3,3-difluoro-1-propan-2-ylsulfonyl-2,6-dihydropyridin-4-yl) trifluoromethanesulfonate.
| Compound Name | (3,3-difluoro-1-propan-2-ylsulfonyl-2,6-dihydropyridin-4-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 176620615 |
| Molecular Formula | C9H12F5NO5S2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | (3,3-difluoro-1-propan-2-ylsulfonyl-2,6-dihydropyridin-4-yl) trifluoromethanesulfonate |
| SMILES | CC(C)S(=O)(=O)N1CC=C(OS(=O)(=O)C(F)(F)F)C(F)(F)C1 |
| InChI | InChI=1S/C9H12F5NO5S2/c1-6(2)21(16,17)15-4-3-7(8(10,11)5-15)20-22(18,19)9(12,13)14/h3,6H,4-5H2,1-2H3 |
| InChIKey | NPDGKJBFKFIUDU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|