C21H22BrF2N5O5 — CID 176621486
[(3R)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]piperidin-1-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 176621486) has the molecular formula C21H22BrF2N5O5 and a molecular weight of 542.34 g/mol. Its IUPAC name is [(3R)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]piperidin-1-yl]-(1,2-oxazol-5-yl)methanone.
| Compound Name | [(3R)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]piperidin-1-yl]-(1,2-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 176621486 |
| Molecular Formula | C21H22BrF2N5O5 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 541.08 |
| IUPAC Name | [(3R)-3-[4-bromo-2-(4,4-difluoropiperidine-1-carbonyl)-6-nitroanilino]piperidin-1-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | O=C(c1ccno1)N1CCC[C@@H](Nc2c(C(=O)N3CCC(F)(F)CC3)cc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H22BrF2N5O5/c22-13-10-15(19(30)27-8-4-21(23,24)5-9-27)18(16(11-13)29(32)33)26-14-2-1-7-28(12-14)20(31)17-3-6-25-34-17/h3,6,10-11,14,26H,1-2,4-5,7-9,12H2/t14-/m1/s1 |
| InChIKey | OWMHKOVBQPOPLT-CQSZACIVSA-N |
| XLogP | 3.93 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|