About 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole
4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole (PubChem CID 176621631) has the molecular formula C17H31N3O
and a molecular weight of 293.45 g/mol. Its IUPAC name is 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole.
Molecular Properties
| Compound Name | 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole |
| PubChem CID | 176621631 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole |
| SMILES | Cn1cnc(CO[C@H]2CN(C(C)(C)C)CC2C(C)(C)C)c1 |
| InChI | InChI=1S/C17H31N3O/c1-16(2,3)14-9-20(17(4,5)6)10-15(14)21-11-13-8-19(7)12-18-13/h8,12,14-15H,9-11H2,1-7H3/t14?,15-/m0/s1 |
| InChIKey | HXYSAMHOFLGJJS-LOACHALJSA-N |
| XLogP | 3.08 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole?
The IUPAC name of 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole (CID 176621631) is 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole.
What is the SMILES notation for 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole?
The canonical SMILES for 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole is Cn1cnc(CO[C@H]2CN(C(C)(C)C)CC2C(C)(C)C)c1.
What is the InChIKey of 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole?
The InChIKey is HXYSAMHOFLGJJS-LOACHALJSA-N. The full InChI is InChI=1S/C17H31N3O/c1-16(2,3)14-9-20(17(4,5)6)10-15(14)21-11-13-8-19(7)12-18-13/h8,12,14-15H,9-11H2,1-7H3/t14?,15-/m0/s1.
What are the key properties of 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole?
4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole has a molecular weight of 293.45 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3R)-1,4-ditert-butylpyrrolidin-3-yl]oxymethyl]-1-methylimidazole is sourced from PubChem (CID 176621631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).