About 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane
3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane (PubChem CID 176621699) has the molecular formula C3H3BO3
and a molecular weight of 97.87 g/mol. Its IUPAC name is 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane.
Molecular Properties
| Compound Name | 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane |
| PubChem CID | 176621699 |
| Molecular Formula | C3H3BO3 |
| Molecular Weight | 97.87 g/mol |
| Exact Mass | 98.02 |
| IUPAC Name | 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane |
| SMILES | C=CC12OB(O1)O2 |
| InChI | InChI=1S/C3H3BO3/c1-2-3-5-4(6-3)7-3/h2H,1H2 |
| InChIKey | ONQVDAIUIHQCQY-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 97.87 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane?
The IUPAC name of 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane (CID 176621699) is 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane.
What is the SMILES notation for 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane?
The canonical SMILES for 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane is C=CC12OB(O1)O2.
What is the InChIKey of 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane?
The InChIKey is ONQVDAIUIHQCQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3BO3/c1-2-3-5-4(6-3)7-3/h2H,1H2.
What are the key properties of 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane?
3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane has a molecular weight of 97.87 g/mol, XLogP of -0.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-2,4,5-trioxa-1-borabicyclo[1.1.1]pentane is sourced from PubChem (CID 176621699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).