C14H26N2O3 — CID 176621863
tert-butyl N-(azetidin-3-yl)-N-(4-hydroxycyclohexyl)carbamate (PubChem CID 176621863) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is tert-butyl N-(azetidin-3-yl)-N-(4-hydroxycyclohexyl)carbamate.
| Compound Name | tert-butyl N-(azetidin-3-yl)-N-(4-hydroxycyclohexyl)carbamate |
|---|---|
| PubChem CID | 176621863 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | tert-butyl N-(azetidin-3-yl)-N-(4-hydroxycyclohexyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(C1CCC(O)CC1)C1CNC1 |
| InChI | InChI=1S/C14H26N2O3/c1-14(2,3)19-13(18)16(11-8-15-9-11)10-4-6-12(17)7-5-10/h10-12,15,17H,4-9H2,1-3H3 |
| InChIKey | DAZXTSFCTSXKFU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |