About 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole
2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole (PubChem CID 176621868) has the molecular formula C19H16N2
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole |
| PubChem CID | 176621868 |
| Molecular Formula | C19H16N2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole |
| SMILES | Cc1ccc(-c2ccc3c(n2)[nH]c2ccccc23)c(C)c1 |
| InChI | InChI=1S/C19H16N2/c1-12-7-8-14(13(2)11-12)18-10-9-16-15-5-3-4-6-17(15)20-19(16)21-18/h3-11H,1-2H3,(H,20,21) |
| InChIKey | ZPNLELFVYCLBDB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole?
The IUPAC name of 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole (CID 176621868) is 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole?
The canonical SMILES for 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole is Cc1ccc(-c2ccc3c(n2)[nH]c2ccccc23)c(C)c1.
What is the InChIKey of 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole?
The InChIKey is ZPNLELFVYCLBDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2/c1-12-7-8-14(13(2)11-12)18-10-9-16-15-5-3-4-6-17(15)20-19(16)21-18/h3-11H,1-2H3,(H,20,21).
What are the key properties of 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole?
2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole has a molecular weight of 272.35 g/mol, XLogP of 5.00, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 176621868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).